C16H27N — CID 114027005
1-(2,6-dimethylphenyl)-N-ethylhexan-1-amine (PubChem CID 114027005) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-N-ethylhexan-1-amine.
| Compound Name | 1-(2,6-dimethylphenyl)-N-ethylhexan-1-amine |
|---|---|
| PubChem CID | 114027005 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-N-ethylhexan-1-amine |
| SMILES | CCCCCC(NCC)c1c(C)cccc1C |
| InChI | InChI=1S/C16H27N/c1-5-7-8-12-15(17-6-2)16-13(3)10-9-11-14(16)4/h9-11,15,17H,5-8,12H2,1-4H3 |
| InChIKey | GOGLHSAXNMGKMJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|