C15H25NO2 — CID 116810587
1-(2,6-dimethoxyphenyl)-N-ethylpentan-1-amine (PubChem CID 116810587) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenyl)-N-ethylpentan-1-amine.
| Compound Name | 1-(2,6-dimethoxyphenyl)-N-ethylpentan-1-amine |
|---|---|
| PubChem CID | 116810587 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 1-(2,6-dimethoxyphenyl)-N-ethylpentan-1-amine |
| SMILES | CCCCC(NCC)c1c(OC)cccc1OC |
| InChI | InChI=1S/C15H25NO2/c1-5-7-9-12(16-6-2)15-13(17-3)10-8-11-14(15)18-4/h8,10-12,16H,5-7,9H2,1-4H3 |
| InChIKey | LZSJSLJUQYTCBO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |