C20H37NO — CID 173447782
1-(2,3-dimethylphenyl)dodecan-1-amine;hydrate (PubChem CID 173447782) has the molecular formula C20H37NO and a molecular weight of 307.52 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)dodecan-1-amine;hydrate.
| Compound Name | 1-(2,3-dimethylphenyl)dodecan-1-amine;hydrate |
|---|---|
| PubChem CID | 173447782 |
| Molecular Formula | C20H37NO |
| Molecular Weight | 307.52 g/mol |
| Exact Mass | 307.29 |
| IUPAC Name | 1-(2,3-dimethylphenyl)dodecan-1-amine;hydrate |
| SMILES | CCCCCCCCCCCC(N)c1cccc(C)c1C.O |
| InChI | InChI=1S/C20H35N.H2O/c1-4-5-6-7-8-9-10-11-12-16-20(21)19-15-13-14-17(2)18(19)3;/h13-15,20H,4-12,16,21H2,1-3H3;1H2 |
| InChIKey | KLTUXGZWDFZRDQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|