C16H25N — CID 107011723
1-(2,3-dimethylphenyl)oct-7-en-1-amine (PubChem CID 107011723) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)oct-7-en-1-amine.
| Compound Name | 1-(2,3-dimethylphenyl)oct-7-en-1-amine |
|---|---|
| PubChem CID | 107011723 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 1-(2,3-dimethylphenyl)oct-7-en-1-amine |
| SMILES | C=CCCCCCC(N)c1cccc(C)c1C |
| InChI | InChI=1S/C16H25N/c1-4-5-6-7-8-12-16(17)15-11-9-10-13(2)14(15)3/h4,9-11,16H,1,5-8,12,17H2,2-3H3 |
| InChIKey | AFMQVDDRKDNSMF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|