C20H34FN2O+ — CID 155693361
ethane;N-(4-fluoro-2,6-dimethylphenyl)-2-(1-methylpyrrolidin-1-ium-1-yl)pentanamide (PubChem CID 155693361) has the molecular formula C20H34FN2O+ and a molecular weight of 337.50 g/mol. Its IUPAC name is ethane;N-(4-fluoro-2,6-dimethylphenyl)-2-(1-methylpyrrolidin-1-ium-1-yl)pentanamide.
| Compound Name | ethane;N-(4-fluoro-2,6-dimethylphenyl)-2-(1-methylpyrrolidin-1-ium-1-yl)pentanamide |
|---|---|
| PubChem CID | 155693361 |
| Molecular Formula | C20H34FN2O+ |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | ethane;N-(4-fluoro-2,6-dimethylphenyl)-2-(1-methylpyrrolidin-1-ium-1-yl)pentanamide |
| SMILES | CC.CCCC(C(=O)Nc1c(C)cc(F)cc1C)[N+]1(C)CCCC1 |
| InChI | InChI=1S/C18H27FN2O.C2H6/c1-5-8-16(21(4)9-6-7-10-21)18(22)20-17-13(2)11-15(19)12-14(17)3;1-2/h11-12,16H,5-10H2,1-4H3;1-2H3/p+1 |
| InChIKey | LPVIZFRTTMLBDG-UHFFFAOYSA-O |
| XLogP | 4.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|