C27H40FN2OY+ — CID 161469239
2-(1-ethylazepan-1-ium-1-yl)-N-(4-fluoro-2,6-dimethylphenyl)butanamide;toluene;yttrium (PubChem CID 161469239) has the molecular formula C27H40FN2OY+ and a molecular weight of 516.53 g/mol. Its IUPAC name is 2-(1-ethylazepan-1-ium-1-yl)-N-(4-fluoro-2,6-dimethylphenyl)butanamide;toluene;yttrium.
| Compound Name | 2-(1-ethylazepan-1-ium-1-yl)-N-(4-fluoro-2,6-dimethylphenyl)butanamide;toluene;yttrium |
|---|---|
| PubChem CID | 161469239 |
| Molecular Formula | C27H40FN2OY+ |
| Molecular Weight | 516.53 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | 2-(1-ethylazepan-1-ium-1-yl)-N-(4-fluoro-2,6-dimethylphenyl)butanamide;toluene;yttrium |
| SMILES | CCC(C(=O)Nc1c(C)cc(F)cc1C)[N+]1(CC)CCCCCC1.Cc1ccccc1.[Y] |
| InChI | InChI=1S/C20H31FN2O.C7H8.Y/c1-5-18(23(6-2)11-9-7-8-10-12-23)20(24)22-19-15(3)13-17(21)14-16(19)4;1-7-5-3-2-4-6-7;/h13-14,18H,5-12H2,1-4H3;2-6H,1H3;/p+1 |
| InChIKey | FBFKFGAAMMRZRA-UHFFFAOYSA-O |
| XLogP | 6.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.53 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|