C26H39N2O2Y+ — CID 157178526
2-(1-ethylpyrrolidin-1-ium-1-yl)-N-(4-methoxy-2,6-dimethylphenyl)butanamide;toluene;yttrium (PubChem CID 157178526) has the molecular formula C26H39N2O2Y+ and a molecular weight of 500.52 g/mol. Its IUPAC name is 2-(1-ethylpyrrolidin-1-ium-1-yl)-N-(4-methoxy-2,6-dimethylphenyl)butanamide;toluene;yttrium.
| Compound Name | 2-(1-ethylpyrrolidin-1-ium-1-yl)-N-(4-methoxy-2,6-dimethylphenyl)butanamide;toluene;yttrium |
|---|---|
| PubChem CID | 157178526 |
| Molecular Formula | C26H39N2O2Y+ |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 2-(1-ethylpyrrolidin-1-ium-1-yl)-N-(4-methoxy-2,6-dimethylphenyl)butanamide;toluene;yttrium |
| SMILES | CCC(C(=O)Nc1c(C)cc(OC)cc1C)[N+]1(CC)CCCC1.Cc1ccccc1.[Y] |
| InChI | InChI=1S/C19H30N2O2.C7H8.Y/c1-6-17(21(7-2)10-8-9-11-21)19(22)20-18-14(3)12-16(23-5)13-15(18)4;1-7-5-3-2-4-6-7;/h12-13,17H,6-11H2,1-5H3;2-6H,1H3;/p+1 |
| InChIKey | SOZJWVCVUFCRSR-UHFFFAOYSA-O |
| XLogP | 5.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|