C25H35BrN2O — CID 155100270
2-(1-benzylpiperidin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)butanamide bromide (PubChem CID 155100270) has the molecular formula C25H35BrN2O and a molecular weight of 459.47 g/mol. Its IUPAC name is 2-(1-benzylpiperidin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)butanamide bromide.
| Compound Name | 2-(1-benzylpiperidin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)butanamide bromide |
|---|---|
| PubChem CID | 155100270 |
| Molecular Formula | C25H35BrN2O |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 2-(1-benzylpiperidin-1-ium-1-yl)-N-(2,4,6-trimethylphenyl)butanamide bromide |
| SMILES | CCC(C(=O)Nc1c(C)cc(C)cc1C)[N+]1(Cc2ccccc2)CCCCC1.[Br-] |
| InChI | InChI=1S/C25H34N2O.BrH/c1-5-23(25(28)26-24-20(3)16-19(2)17-21(24)4)27(14-10-7-11-15-27)18-22-12-8-6-9-13-22;/h6,8-9,12-13,16-17,23H,5,7,10-11,14-15,18H2,1-4H3;1H |
| InChIKey | YCSLEPPDKTZHSQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|