C25H35N2O2+ — CID 155100164
N-(2,6-dimethylphenyl)-2-[1-[(2-methoxyphenyl)methyl]piperidin-1-ium-1-yl]butanamide (PubChem CID 155100164) has the molecular formula C25H35N2O2+ and a molecular weight of 395.57 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[1-[(2-methoxyphenyl)methyl]piperidin-1-ium-1-yl]butanamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[1-[(2-methoxyphenyl)methyl]piperidin-1-ium-1-yl]butanamide |
|---|---|
| PubChem CID | 155100164 |
| Molecular Formula | C25H35N2O2+ |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[1-[(2-methoxyphenyl)methyl]piperidin-1-ium-1-yl]butanamide |
| SMILES | CCC(C(=O)Nc1c(C)cccc1C)[N+]1(Cc2ccccc2OC)CCCCC1 |
| InChI | InChI=1S/C25H34N2O2/c1-5-22(25(28)26-24-19(2)12-11-13-20(24)3)27(16-9-6-10-17-27)18-21-14-7-8-15-23(21)29-4/h7-8,11-15,22H,5-6,9-10,16-18H2,1-4H3/p+1 |
| InChIKey | LLDLMVNFEUIYBT-UHFFFAOYSA-O |
| XLogP | 5.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|