C22H31N2OS+ — CID 155614984
N-(2,6-dimethylphenyl)-2-[1-(thiophen-3-ylmethyl)piperidin-1-ium-1-yl]butanamide (PubChem CID 155614984) has the molecular formula C22H31N2OS+ and a molecular weight of 371.57 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[1-(thiophen-3-ylmethyl)piperidin-1-ium-1-yl]butanamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[1-(thiophen-3-ylmethyl)piperidin-1-ium-1-yl]butanamide |
|---|---|
| PubChem CID | 155614984 |
| Molecular Formula | C22H31N2OS+ |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[1-(thiophen-3-ylmethyl)piperidin-1-ium-1-yl]butanamide |
| SMILES | CCC(C(=O)Nc1c(C)cccc1C)[N+]1(Cc2ccsc2)CCCCC1 |
| InChI | InChI=1S/C22H30N2OS/c1-4-20(22(25)23-21-17(2)9-8-10-18(21)3)24(12-6-5-7-13-24)15-19-11-14-26-16-19/h8-11,14,16,20H,4-7,12-13,15H2,1-3H3/p+1 |
| InChIKey | WGCYJZRYNGOUGB-UHFFFAOYSA-O |
| XLogP | 5.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|