C19H29N2O3+ — CID 158612778
methyl 2-[2-(1-ethylpiperidin-1-ium-1-yl)propanoylamino]-3-methylbenzoate (PubChem CID 158612778) has the molecular formula C19H29N2O3+ and a molecular weight of 333.45 g/mol. Its IUPAC name is methyl 2-[2-(1-ethylpiperidin-1-ium-1-yl)propanoylamino]-3-methylbenzoate.
| Compound Name | methyl 2-[2-(1-ethylpiperidin-1-ium-1-yl)propanoylamino]-3-methylbenzoate |
|---|---|
| PubChem CID | 158612778 |
| Molecular Formula | C19H29N2O3+ |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | methyl 2-[2-(1-ethylpiperidin-1-ium-1-yl)propanoylamino]-3-methylbenzoate |
| SMILES | CC[N+]1(C(C)C(=O)Nc2c(C)cccc2C(=O)OC)CCCCC1 |
| InChI | InChI=1S/C19H28N2O3/c1-5-21(12-7-6-8-13-21)15(3)18(22)20-17-14(2)10-9-11-16(17)19(23)24-4/h9-11,15H,5-8,12-13H2,1-4H3/p+1 |
| InChIKey | MECFZFAMHORNCC-UHFFFAOYSA-O |
| XLogP | 3.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|