C20H28N3O3+ — CID 159934084
methyl 2-[2-(1-ethylpyrrolidin-1-ium-1-yl)butanoylamino]-5-isocyano-3-methylbenzoate (PubChem CID 159934084) has the molecular formula C20H28N3O3+ and a molecular weight of 358.46 g/mol. Its IUPAC name is methyl 2-[2-(1-ethylpyrrolidin-1-ium-1-yl)butanoylamino]-5-isocyano-3-methylbenzoate.
| Compound Name | methyl 2-[2-(1-ethylpyrrolidin-1-ium-1-yl)butanoylamino]-5-isocyano-3-methylbenzoate |
|---|---|
| PubChem CID | 159934084 |
| Molecular Formula | C20H28N3O3+ |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | methyl 2-[2-(1-ethylpyrrolidin-1-ium-1-yl)butanoylamino]-5-isocyano-3-methylbenzoate |
| SMILES | [C-]#[N+]c1cc(C)c(NC(=O)C(CC)[N+]2(CC)CCCC2)c(C(=O)OC)c1 |
| InChI | InChI=1S/C20H27N3O3/c1-6-17(23(7-2)10-8-9-11-23)19(24)22-18-14(3)12-15(21-4)13-16(18)20(25)26-5/h12-13,17H,6-11H2,1-3,5H3/p+1 |
| InChIKey | LOLXBPPJDQFDQM-UHFFFAOYSA-O |
| XLogP | 3.68 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|