C19H31N2O2+ — CID 160537356
2-(1-ethylpiperidin-1-ium-1-yl)-N-(4-methoxy-2,6-dimethylphenyl)propanamide (PubChem CID 160537356) has the molecular formula C19H31N2O2+ and a molecular weight of 319.47 g/mol. Its IUPAC name is 2-(1-ethylpiperidin-1-ium-1-yl)-N-(4-methoxy-2,6-dimethylphenyl)propanamide.
| Compound Name | 2-(1-ethylpiperidin-1-ium-1-yl)-N-(4-methoxy-2,6-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 160537356 |
| Molecular Formula | C19H31N2O2+ |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | 2-(1-ethylpiperidin-1-ium-1-yl)-N-(4-methoxy-2,6-dimethylphenyl)propanamide |
| SMILES | CC[N+]1(C(C)C(=O)Nc2c(C)cc(OC)cc2C)CCCCC1 |
| InChI | InChI=1S/C19H30N2O2/c1-6-21(10-8-7-9-11-21)16(4)19(22)20-18-14(2)12-17(23-5)13-15(18)3/h12-13,16H,6-11H2,1-5H3/p+1 |
| InChIKey | KGHGHDXRYHXCLI-UHFFFAOYSA-O |
| XLogP | 3.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|