C31H43N2O6+ — CID 170269780
ethyl 5-methoxy-3-methyl-2-[2-[1-(2-oxo-2-phenylmethoxyethyl)azepan-1-ium-1-yl]pentanoylamino]benzoate (PubChem CID 170269780) has the molecular formula C31H43N2O6+ and a molecular weight of 539.69 g/mol. Its IUPAC name is ethyl 5-methoxy-3-methyl-2-[2-[1-(2-oxo-2-phenylmethoxyethyl)azepan-1-ium-1-yl]pentanoylamino]benzoate.
| Compound Name | ethyl 5-methoxy-3-methyl-2-[2-[1-(2-oxo-2-phenylmethoxyethyl)azepan-1-ium-1-yl]pentanoylamino]benzoate |
|---|---|
| PubChem CID | 170269780 |
| Molecular Formula | C31H43N2O6+ |
| Molecular Weight | 539.69 g/mol |
| Exact Mass | 539.31 |
| IUPAC Name | ethyl 5-methoxy-3-methyl-2-[2-[1-(2-oxo-2-phenylmethoxyethyl)azepan-1-ium-1-yl]pentanoylamino]benzoate |
| SMILES | CCCC(C(=O)Nc1c(C)cc(OC)cc1C(=O)OCC)[N+]1(CC(=O)OCc2ccccc2)CCCCCC1 |
| InChI | InChI=1S/C31H42N2O6/c1-5-14-27(30(35)32-29-23(3)19-25(37-4)20-26(29)31(36)38-6-2)33(17-12-7-8-13-18-33)21-28(34)39-22-24-15-10-9-11-16-24/h9-11,15-16,19-20,27H,5-8,12-14,17-18,21-22H2,1-4H3/p+1 |
| InChIKey | BAHKMQFLTVVKRQ-UHFFFAOYSA-O |
| XLogP | 5.42 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.69 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|