C29H38FN2O5+ — CID 170269729
ethyl 5-fluoro-3-methyl-2-[2-[1-(2-oxo-2-phenylmethoxyethyl)piperidin-1-ium-1-yl]pentanoylamino]benzoate (PubChem CID 170269729) has the molecular formula C29H38FN2O5+ and a molecular weight of 513.63 g/mol. Its IUPAC name is ethyl 5-fluoro-3-methyl-2-[2-[1-(2-oxo-2-phenylmethoxyethyl)piperidin-1-ium-1-yl]pentanoylamino]benzoate.
| Compound Name | ethyl 5-fluoro-3-methyl-2-[2-[1-(2-oxo-2-phenylmethoxyethyl)piperidin-1-ium-1-yl]pentanoylamino]benzoate |
|---|---|
| PubChem CID | 170269729 |
| Molecular Formula | C29H38FN2O5+ |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | ethyl 5-fluoro-3-methyl-2-[2-[1-(2-oxo-2-phenylmethoxyethyl)piperidin-1-ium-1-yl]pentanoylamino]benzoate |
| SMILES | CCCC(C(=O)Nc1c(C)cc(F)cc1C(=O)OCC)[N+]1(CC(=O)OCc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C29H37FN2O5/c1-4-12-25(28(34)31-27-21(3)17-23(30)18-24(27)29(35)36-5-2)32(15-10-7-11-16-32)19-26(33)37-20-22-13-8-6-9-14-22/h6,8-9,13-14,17-18,25H,4-5,7,10-12,15-16,19-20H2,1-3H3/p+1 |
| InChIKey | NHKUXKRCWPWFJC-UHFFFAOYSA-O |
| XLogP | 5.16 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|