C19H25N2O2+ — CID 3124102
N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)-2-pyridin-1-ium-1-ylacetamide (PubChem CID 3124102) has the molecular formula C19H25N2O2+ and a molecular weight of 313.42 g/mol. Its IUPAC name is N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)-2-pyridin-1-ium-1-ylacetamide.
| Compound Name | N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)-2-pyridin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 3124102 |
| Molecular Formula | C19H25N2O2+ |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)-2-pyridin-1-ium-1-ylacetamide |
| SMILES | CCOCN(C(=O)C[n+]1ccccc1)c1c(C)cccc1CC |
| InChI | InChI=1S/C19H25N2O2/c1-4-17-11-9-10-16(3)19(17)21(15-23-5-2)18(22)14-20-12-7-6-8-13-20/h6-13H,4-5,14-15H2,1-3H3/q+1 |
| InChIKey | WXVSUVBPNOUCQU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|