C16H21Cl2NO3 — CID 57299901
2,2-dichloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)-3-oxobutanamide (PubChem CID 57299901) has the molecular formula C16H21Cl2NO3 and a molecular weight of 346.25 g/mol. Its IUPAC name is 2,2-dichloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)-3-oxobutanamide.
| Compound Name | 2,2-dichloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)-3-oxobutanamide |
|---|---|
| PubChem CID | 57299901 |
| Molecular Formula | C16H21Cl2NO3 |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2,2-dichloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)-3-oxobutanamide |
| SMILES | CCOCN(C(=O)C(Cl)(Cl)C(C)=O)c1c(C)cccc1CC |
| InChI | InChI=1S/C16H21Cl2NO3/c1-5-13-9-7-8-11(3)14(13)19(10-22-6-2)15(21)16(17,18)12(4)20/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | LANXIROVQJDOQW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|