C18H19NO — CID 157328238
1-(benzylideneamino)-3-(2,6-dimethylphenyl)propan-2-one (PubChem CID 157328238) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is 1-(benzylideneamino)-3-(2,6-dimethylphenyl)propan-2-one.
| Compound Name | 1-(benzylideneamino)-3-(2,6-dimethylphenyl)propan-2-one |
|---|---|
| PubChem CID | 157328238 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 1-(benzylideneamino)-3-(2,6-dimethylphenyl)propan-2-one |
| SMILES | Cc1cccc(C)c1CC(=O)C/N=C/c1ccccc1 |
| InChI | InChI=1S/C18H19NO/c1-14-7-6-8-15(2)18(14)11-17(20)13-19-12-16-9-4-3-5-10-16/h3-10,12H,11,13H2,1-2H3/b19-12+ |
| InChIKey | RUEGEBIUKSJMGA-XDHOZWIPSA-N |
| XLogP | 3.53 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|