C26H24N2S2 — CID 159735954
1-(2,6-dimethylphenyl)-3-[[2-(4-methylphenyl)-1,3-benzothiazol-5-yl]methylideneamino]propane-2-thione (PubChem CID 159735954) has the molecular formula C26H24N2S2 and a molecular weight of 428.63 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[[2-(4-methylphenyl)-1,3-benzothiazol-5-yl]methylideneamino]propane-2-thione.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[[2-(4-methylphenyl)-1,3-benzothiazol-5-yl]methylideneamino]propane-2-thione |
|---|---|
| PubChem CID | 159735954 |
| Molecular Formula | C26H24N2S2 |
| Molecular Weight | 428.63 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[[2-(4-methylphenyl)-1,3-benzothiazol-5-yl]methylideneamino]propane-2-thione |
| SMILES | Cc1ccc(-c2nc3cc(/C=N/CC(=S)Cc4c(C)cccc4C)ccc3s2)cc1 |
| InChI | InChI=1S/C26H24N2S2/c1-17-7-10-21(11-8-17)26-28-24-13-20(9-12-25(24)30-26)15-27-16-22(29)14-23-18(2)5-4-6-19(23)3/h4-13,15H,14,16H2,1-3H3/b27-15+ |
| InChIKey | UFFPKVOQYZLTRY-JFLMPSFJSA-N |
| XLogP | 6.92 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.63 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|