C13H17BrO — CID 157470382
3-bromo-1-(2,6-dimethylphenyl)-3-methylbutan-2-one (PubChem CID 157470382) has the molecular formula C13H17BrO and a molecular weight of 269.18 g/mol. Its IUPAC name is 3-bromo-1-(2,6-dimethylphenyl)-3-methylbutan-2-one.
| Compound Name | 3-bromo-1-(2,6-dimethylphenyl)-3-methylbutan-2-one |
|---|---|
| PubChem CID | 157470382 |
| Molecular Formula | C13H17BrO |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 3-bromo-1-(2,6-dimethylphenyl)-3-methylbutan-2-one |
| SMILES | Cc1cccc(C)c1CC(=O)C(C)(C)Br |
| InChI | InChI=1S/C13H17BrO/c1-9-6-5-7-10(2)11(9)8-12(15)13(3,4)14/h5-7H,8H2,1-4H3 |
| InChIKey | KMAWEVGEWFJPLW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|