C19H25N2O3Y+ — CID 159562779
ethyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-2,5-dimethylpyrazol-2-ium-3-carboxylate;yttrium (PubChem CID 159562779) has the molecular formula C19H25N2O3Y+ and a molecular weight of 418.33 g/mol. Its IUPAC name is ethyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-2,5-dimethylpyrazol-2-ium-3-carboxylate;yttrium.
| Compound Name | ethyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-2,5-dimethylpyrazol-2-ium-3-carboxylate;yttrium |
|---|---|
| PubChem CID | 159562779 |
| Molecular Formula | C19H25N2O3Y+ |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | ethyl 1-[3-(2,6-dimethylphenyl)-2-oxopropyl]-2,5-dimethylpyrazol-2-ium-3-carboxylate;yttrium |
| SMILES | CCOC(=O)c1cc(C)n(CC(=O)Cc2c(C)cccc2C)[n+]1C.[Y] |
| InChI | InChI=1S/C19H25N2O3.Y/c1-6-24-19(23)18-10-15(4)21(20(18)5)12-16(22)11-17-13(2)8-7-9-14(17)3;/h7-10H,6,11-12H2,1-5H3;/q+1; |
| InChIKey | STFIZTDRLQYZBX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|