About triethyl-[1-(methylcarbamoyl)cyclopropyl]azanium;yttrium
triethyl-[1-(methylcarbamoyl)cyclopropyl]azanium;yttrium (PubChem CID 160837194) has the molecular formula C11H23N2OY+
and a molecular weight of 288.22 g/mol. Its IUPAC name is triethyl-[1-(methylcarbamoyl)cyclopropyl]azanium;yttrium.
Molecular Properties
| Compound Name | triethyl-[1-(methylcarbamoyl)cyclopropyl]azanium;yttrium |
| PubChem CID | 160837194 |
| Molecular Formula | C11H23N2OY+ |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | triethyl-[1-(methylcarbamoyl)cyclopropyl]azanium;yttrium |
| SMILES | CC[N+](CC)(CC)C1(C(=O)NC)CC1.[Y] |
| InChI | InChI=1S/C11H22N2O.Y/c1-5-13(6-2,7-3)11(8-9-11)10(14)12-4;/h5-9H2,1-4H3;/p+1 |
| InChIKey | AFNXAWKNJRQRNZ-UHFFFAOYSA-O |
| XLogP | 1.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[1-(methylcarbamoyl)cyclopropyl]azanium;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[1-(methylcarbamoyl)cyclopropyl]azanium;yttrium?
The IUPAC name of triethyl-[1-(methylcarbamoyl)cyclopropyl]azanium;yttrium (CID 160837194) is triethyl-[1-(methylcarbamoyl)cyclopropyl]azanium;yttrium.
What is the SMILES notation for triethyl-[1-(methylcarbamoyl)cyclopropyl]azanium;yttrium?
The canonical SMILES for triethyl-[1-(methylcarbamoyl)cyclopropyl]azanium;yttrium is CC[N+](CC)(CC)C1(C(=O)NC)CC1.[Y].
What is the InChIKey of triethyl-[1-(methylcarbamoyl)cyclopropyl]azanium;yttrium?
The InChIKey is AFNXAWKNJRQRNZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H22N2O.Y/c1-5-13(6-2,7-3)11(8-9-11)10(14)12-4;/h5-9H2,1-4H3;/p+1.
What are the key properties of triethyl-[1-(methylcarbamoyl)cyclopropyl]azanium;yttrium?
triethyl-[1-(methylcarbamoyl)cyclopropyl]azanium;yttrium has a molecular weight of 288.22 g/mol, XLogP of 1.14, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[1-(methylcarbamoyl)cyclopropyl]azanium;yttrium is sourced from PubChem (CID 160837194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).