C7H12FNO — CID 126985970
1-(2-fluoroethyl)-N-methylcyclopropane-1-carboxamide (PubChem CID 126985970) has the molecular formula C7H12FNO and a molecular weight of 145.18 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-N-methylcyclopropane-1-carboxamide.
| Compound Name | 1-(2-fluoroethyl)-N-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 126985970 |
| Molecular Formula | C7H12FNO |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 1-(2-fluoroethyl)-N-methylcyclopropane-1-carboxamide |
| SMILES | CNC(=O)C1(CCF)CC1 |
| InChI | InChI=1S/C7H12FNO/c1-9-6(10)7(2-3-7)4-5-8/h2-5H2,1H3,(H,9,10) |
| InChIKey | NJPNZVMOSGEGJK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |