C12H26N2O3S — CID 163233842
ethane;4-ethyl-N-methyl-1-methylsulfonylpiperidine-4-carboxamide (PubChem CID 163233842) has the molecular formula C12H26N2O3S and a molecular weight of 278.42 g/mol. Its IUPAC name is ethane;4-ethyl-N-methyl-1-methylsulfonylpiperidine-4-carboxamide.
| Compound Name | ethane;4-ethyl-N-methyl-1-methylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 163233842 |
| Molecular Formula | C12H26N2O3S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | ethane;4-ethyl-N-methyl-1-methylsulfonylpiperidine-4-carboxamide |
| SMILES | CC.CCC1(C(=O)NC)CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C10H20N2O3S.C2H6/c1-4-10(9(13)11-2)5-7-12(8-6-10)16(3,14)15;1-2/h4-8H2,1-3H3,(H,11,13);1-2H3 |
| InChIKey | BUKNXXIBABHDBH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |