C9H17ClN2O3S — CID 106321277
1-(2-chloroethylsulfonyl)-N,3-dimethylpyrrolidine-3-carboxamide (PubChem CID 106321277) has the molecular formula C9H17ClN2O3S and a molecular weight of 268.77 g/mol. Its IUPAC name is 1-(2-chloroethylsulfonyl)-N,3-dimethylpyrrolidine-3-carboxamide.
| Compound Name | 1-(2-chloroethylsulfonyl)-N,3-dimethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 106321277 |
| Molecular Formula | C9H17ClN2O3S |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 1-(2-chloroethylsulfonyl)-N,3-dimethylpyrrolidine-3-carboxamide |
| SMILES | CNC(=O)C1(C)CCN(S(=O)(=O)CCCl)C1 |
| InChI | InChI=1S/C9H17ClN2O3S/c1-9(8(13)11-2)3-5-12(7-9)16(14,15)6-4-10/h3-7H2,1-2H3,(H,11,13) |
| InChIKey | NUMLEHSZNNKGES-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|