C8H15IN2O — CID 129191927
1-iodo-N,4-dimethylpiperidine-4-carboxamide (PubChem CID 129191927) has the molecular formula C8H15IN2O and a molecular weight of 282.12 g/mol. Its IUPAC name is 1-iodo-N,4-dimethylpiperidine-4-carboxamide.
| Compound Name | 1-iodo-N,4-dimethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 129191927 |
| Molecular Formula | C8H15IN2O |
| Molecular Weight | 282.12 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 1-iodo-N,4-dimethylpiperidine-4-carboxamide |
| SMILES | CNC(=O)C1(C)CCN(I)CC1 |
| InChI | InChI=1S/C8H15IN2O/c1-8(7(12)10-2)3-5-11(9)6-4-8/h3-6H2,1-2H3,(H,10,12) |
| InChIKey | CPMRXUBTYKZVBM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.12 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|