C10H19N3O2 — CID 106318154
1-(2-aminopropanoyl)-N,3-dimethylpyrrolidine-3-carboxamide (PubChem CID 106318154) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is 1-(2-aminopropanoyl)-N,3-dimethylpyrrolidine-3-carboxamide.
| Compound Name | 1-(2-aminopropanoyl)-N,3-dimethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 106318154 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 1-(2-aminopropanoyl)-N,3-dimethylpyrrolidine-3-carboxamide |
| SMILES | CNC(=O)C1(C)CCN(C(=O)C(C)N)C1 |
| InChI | InChI=1S/C10H19N3O2/c1-7(11)8(14)13-5-4-10(2,6-13)9(15)12-3/h7H,4-6,11H2,1-3H3,(H,12,15) |
| InChIKey | LHGSYCXMGAUVDF-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |