C12H23N3O2 — CID 106318225
1-(2-aminopentanoyl)-N,3-dimethylpyrrolidine-3-carboxamide (PubChem CID 106318225) has the molecular formula C12H23N3O2 and a molecular weight of 241.33 g/mol. Its IUPAC name is 1-(2-aminopentanoyl)-N,3-dimethylpyrrolidine-3-carboxamide.
| Compound Name | 1-(2-aminopentanoyl)-N,3-dimethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 106318225 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 1-(2-aminopentanoyl)-N,3-dimethylpyrrolidine-3-carboxamide |
| SMILES | CCCC(N)C(=O)N1CCC(C)(C(=O)NC)C1 |
| InChI | InChI=1S/C12H23N3O2/c1-4-5-9(13)10(16)15-7-6-12(2,8-15)11(17)14-3/h9H,4-8,13H2,1-3H3,(H,14,17) |
| InChIKey | KRYITWBYSSPOBC-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |