About 3-N,3-dimethyl-1-N-propylpyrrolidine-1,3-dicarboxamide
3-N,3-dimethyl-1-N-propylpyrrolidine-1,3-dicarboxamide (PubChem CID 106103750) has the molecular formula C11H21N3O2
and a molecular weight of 227.31 g/mol. Its IUPAC name is 3-N,3-dimethyl-1-N-propylpyrrolidine-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 3-N,3-dimethyl-1-N-propylpyrrolidine-1,3-dicarboxamide |
| PubChem CID | 106103750 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 3-N,3-dimethyl-1-N-propylpyrrolidine-1,3-dicarboxamide |
| SMILES | CCCNC(=O)N1CCC(C)(C(=O)NC)C1 |
| InChI | InChI=1S/C11H21N3O2/c1-4-6-13-10(16)14-7-5-11(2,8-14)9(15)12-3/h4-8H2,1-3H3,(H,12,15)(H,13,16) |
| InChIKey | GWODXMTUDHXLGA-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-N,3-dimethyl-1-N-propylpyrrolidine-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,3-dimethyl-1-N-propylpyrrolidine-1,3-dicarboxamide?
The IUPAC name of 3-N,3-dimethyl-1-N-propylpyrrolidine-1,3-dicarboxamide (CID 106103750) is 3-N,3-dimethyl-1-N-propylpyrrolidine-1,3-dicarboxamide.
What is the SMILES notation for 3-N,3-dimethyl-1-N-propylpyrrolidine-1,3-dicarboxamide?
The canonical SMILES for 3-N,3-dimethyl-1-N-propylpyrrolidine-1,3-dicarboxamide is CCCNC(=O)N1CCC(C)(C(=O)NC)C1.
What is the InChIKey of 3-N,3-dimethyl-1-N-propylpyrrolidine-1,3-dicarboxamide?
The InChIKey is GWODXMTUDHXLGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O2/c1-4-6-13-10(16)14-7-5-11(2,8-14)9(15)12-3/h4-8H2,1-3H3,(H,12,15)(H,13,16).
What are the key properties of 3-N,3-dimethyl-1-N-propylpyrrolidine-1,3-dicarboxamide?
3-N,3-dimethyl-1-N-propylpyrrolidine-1,3-dicarboxamide has a molecular weight of 227.31 g/mol, XLogP of 0.56, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,3-dimethyl-1-N-propylpyrrolidine-1,3-dicarboxamide is sourced from PubChem (CID 106103750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).