C10H20F2N2O — CID 164555762
3,3-difluoro-N-propylpyrrolidine-1-carboxamide;ethane (PubChem CID 164555762) has the molecular formula C10H20F2N2O and a molecular weight of 222.28 g/mol. Its IUPAC name is 3,3-difluoro-N-propylpyrrolidine-1-carboxamide;ethane.
| Compound Name | 3,3-difluoro-N-propylpyrrolidine-1-carboxamide;ethane |
|---|---|
| PubChem CID | 164555762 |
| Molecular Formula | C10H20F2N2O |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 3,3-difluoro-N-propylpyrrolidine-1-carboxamide;ethane |
| SMILES | CC.CCCNC(=O)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C8H14F2N2O.C2H6/c1-2-4-11-7(13)12-5-3-8(9,10)6-12;1-2/h2-6H2,1H3,(H,11,13);1-2H3 |
| InChIKey | VBEOHOPUEDLMGQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |