C9H17N3O2 — CID 106318155
1-(2-aminoacetyl)-N,3-dimethylpyrrolidine-3-carboxamide (PubChem CID 106318155) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 1-(2-aminoacetyl)-N,3-dimethylpyrrolidine-3-carboxamide.
| Compound Name | 1-(2-aminoacetyl)-N,3-dimethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 106318155 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 1-(2-aminoacetyl)-N,3-dimethylpyrrolidine-3-carboxamide |
| SMILES | CNC(=O)C1(C)CCN(C(=O)CN)C1 |
| InChI | InChI=1S/C9H17N3O2/c1-9(8(14)11-2)3-4-12(6-9)7(13)5-10/h3-6,10H2,1-2H3,(H,11,14) |
| InChIKey | VSQFZHGNRIGLJR-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |