C10H21NO2 — CID 163271298
N,4-dimethyloxane-4-carboxamide;ethane (PubChem CID 163271298) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is N,4-dimethyloxane-4-carboxamide;ethane.
| Compound Name | N,4-dimethyloxane-4-carboxamide;ethane |
|---|---|
| PubChem CID | 163271298 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | N,4-dimethyloxane-4-carboxamide;ethane |
| SMILES | CC.CNC(=O)C1(C)CCOCC1 |
| InChI | InChI=1S/C8H15NO2.C2H6/c1-8(7(10)9-2)3-5-11-6-4-8;1-2/h3-6H2,1-2H3,(H,9,10);1-2H3 |
| InChIKey | UJPPNGRXZLNQTP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |