C5H9NO2 — CID 171036085
N,2-dimethyloxirane-2-carboxamide (PubChem CID 171036085) has the molecular formula C5H9NO2 and a molecular weight of 115.13 g/mol. Its IUPAC name is N,2-dimethyloxirane-2-carboxamide.
| Compound Name | N,2-dimethyloxirane-2-carboxamide |
|---|---|
| PubChem CID | 171036085 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | N,2-dimethyloxirane-2-carboxamide |
| SMILES | CNC(=O)C1(C)CO1 |
| InChI | InChI=1S/C5H9NO2/c1-5(3-8-5)4(7)6-2/h3H2,1-2H3,(H,6,7) |
| InChIKey | VDERJCNXVDMMOS-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|