C19H26N2O — CID 158812787
1-[2-[4-(2-isocyano-2-methylpropyl)phenyl]ethyl]-N-methylcyclobutane-1-carboxamide (PubChem CID 158812787) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-[2-[4-(2-isocyano-2-methylpropyl)phenyl]ethyl]-N-methylcyclobutane-1-carboxamide.
| Compound Name | 1-[2-[4-(2-isocyano-2-methylpropyl)phenyl]ethyl]-N-methylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 158812787 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 1-[2-[4-(2-isocyano-2-methylpropyl)phenyl]ethyl]-N-methylcyclobutane-1-carboxamide |
| SMILES | [C-]#[N+]C(C)(C)Cc1ccc(CCC2(C(=O)NC)CCC2)cc1 |
| InChI | InChI=1S/C19H26N2O/c1-18(2,21-4)14-16-8-6-15(7-9-16)10-13-19(11-5-12-19)17(22)20-3/h6-9H,5,10-14H2,1-3H3,(H,20,22) |
| InChIKey | RULBUGWNDRYDSV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 33.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|