C24H30N2O3 — CID 174447639
methyl (2S)-3-(4-aminophenyl)-2-[[1-(2-phenylethyl)cyclopentanecarbonyl]amino]propanoate (PubChem CID 174447639) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is methyl (2S)-3-(4-aminophenyl)-2-[[1-(2-phenylethyl)cyclopentanecarbonyl]amino]propanoate.
| Compound Name | methyl (2S)-3-(4-aminophenyl)-2-[[1-(2-phenylethyl)cyclopentanecarbonyl]amino]propanoate |
|---|---|
| PubChem CID | 174447639 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | methyl (2S)-3-(4-aminophenyl)-2-[[1-(2-phenylethyl)cyclopentanecarbonyl]amino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(N)cc1)NC(=O)C1(CCc2ccccc2)CCCC1 |
| InChI | InChI=1S/C24H30N2O3/c1-29-22(27)21(17-19-9-11-20(25)12-10-19)26-23(28)24(14-5-6-15-24)16-13-18-7-3-2-4-8-18/h2-4,7-12,21H,5-6,13-17,25H2,1H3,(H,26,28)/t21-/m0/s1 |
| InChIKey | ZGAYECJEYZEJSX-NRFANRHFSA-N |
| XLogP | 3.66 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|