C22H26N2O3 — CID 54536021
methyl (2S)-3-(4-aminophenyl)-2-[(1-phenylcyclopentanecarbonyl)amino]propanoate (PubChem CID 54536021) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is methyl (2S)-3-(4-aminophenyl)-2-[(1-phenylcyclopentanecarbonyl)amino]propanoate.
| Compound Name | methyl (2S)-3-(4-aminophenyl)-2-[(1-phenylcyclopentanecarbonyl)amino]propanoate |
|---|---|
| PubChem CID | 54536021 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | methyl (2S)-3-(4-aminophenyl)-2-[(1-phenylcyclopentanecarbonyl)amino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(N)cc1)NC(=O)C1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C22H26N2O3/c1-27-20(25)19(15-16-9-11-18(23)12-10-16)24-21(26)22(13-5-6-14-22)17-7-3-2-4-8-17/h2-4,7-12,19H,5-6,13-15,23H2,1H3,(H,24,26)/t19-/m0/s1 |
| InChIKey | YZVIWKMKSAXHFC-IBGZPJMESA-N |
| XLogP | 2.98 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|