C24H30N2O4 — CID 23384194
methyl 3-(4-aminophenyl)-2-[[1-(4-methoxyphenyl)cyclohexanecarbonyl]amino]propanoate (PubChem CID 23384194) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is methyl 3-(4-aminophenyl)-2-[[1-(4-methoxyphenyl)cyclohexanecarbonyl]amino]propanoate.
| Compound Name | methyl 3-(4-aminophenyl)-2-[[1-(4-methoxyphenyl)cyclohexanecarbonyl]amino]propanoate |
|---|---|
| PubChem CID | 23384194 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | methyl 3-(4-aminophenyl)-2-[[1-(4-methoxyphenyl)cyclohexanecarbonyl]amino]propanoate |
| SMILES | COC(=O)C(Cc1ccc(N)cc1)NC(=O)C1(c2ccc(OC)cc2)CCCCC1 |
| InChI | InChI=1S/C24H30N2O4/c1-29-20-12-8-18(9-13-20)24(14-4-3-5-15-24)23(28)26-21(22(27)30-2)16-17-6-10-19(25)11-7-17/h6-13,21H,3-5,14-16,25H2,1-2H3,(H,26,28) |
| InChIKey | DSRIDZSNPOIWKJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|