C44H52N4O9 — CID 157478896
methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;methyl (2S)-3-(4-aminophenyl)-2-[(1-phenylcyclopentanecarbonyl)amino]propanoate;1-phenylcyclopentane-1-carboxylic acid (PubChem CID 157478896) has the molecular formula C44H52N4O9 and a molecular weight of 780.92 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;methyl (2S)-3-(4-aminophenyl)-2-[(1-phenylcyclopentanecarbonyl)amino]propanoate;1-phenylcyclopentane-1-carboxylic acid.
| Compound Name | methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;methyl (2S)-3-(4-aminophenyl)-2-[(1-phenylcyclopentanecarbonyl)amino]propanoate;1-phenylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 157478896 |
| Molecular Formula | C44H52N4O9 |
| Molecular Weight | 780.92 g/mol |
| Exact Mass | 780.37 |
| IUPAC Name | methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;methyl (2S)-3-(4-aminophenyl)-2-[(1-phenylcyclopentanecarbonyl)amino]propanoate;1-phenylcyclopentane-1-carboxylic acid |
| SMILES | COC(=O)[C@@H](N)Cc1ccc([N+](=O)[O-])cc1.COC(=O)[C@H](Cc1ccc(N)cc1)NC(=O)C1(c2ccccc2)CCCC1.O=C(O)C1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C22H26N2O3.C12H14O2.C10H12N2O4/c1-27-20(25)19(15-16-9-11-18(23)12-10-16)24-21(26)22(13-5-6-14-22)17-7-3-2-4-8-17;13-11(14)12(8-4-5-9-12)10-6-2-1-3-7-10;1-16-10(13)9(11)6-7-2-4-8(5-3-7)12(14)15/h2-4,7-12,19H,5-6,13-15,23H2,1H3,(H,24,26);1-3,6-7H,4-5,8-9H2,(H,13,14);2-5,9H,6,11H2,1H3/t19-;;9-/m0.0/s1 |
| InChIKey | BVXSWQOWNMACPB-SMAJWRSESA-N |
| XLogP | 6.20 |
| TPSA | 214.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.92 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|