C18H27ClN2OW-2 — CID 155692307
carbanide;N-(4-chloro-2,6-dimethylphenyl)-1-[methyl(propyl)amino]cyclobutane-1-carboxamide;tungsten (PubChem CID 155692307) has the molecular formula C18H27ClN2OW-2 and a molecular weight of 506.72 g/mol. Its IUPAC name is carbanide;N-(4-chloro-2,6-dimethylphenyl)-1-[methyl(propyl)amino]cyclobutane-1-carboxamide;tungsten.
| Compound Name | carbanide;N-(4-chloro-2,6-dimethylphenyl)-1-[methyl(propyl)amino]cyclobutane-1-carboxamide;tungsten |
|---|---|
| PubChem CID | 155692307 |
| Molecular Formula | C18H27ClN2OW-2 |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | carbanide;N-(4-chloro-2,6-dimethylphenyl)-1-[methyl(propyl)amino]cyclobutane-1-carboxamide;tungsten |
| SMILES | [CH2-]CCN(C)C1(C(=O)Nc2c(C)cc(Cl)cc2C)CCC1.[CH3-].[W] |
| InChI | InChI=1S/C17H24ClN2O.CH3.W/c1-5-9-20(4)17(7-6-8-17)16(21)19-15-12(2)10-14(18)11-13(15)3;;/h10-11H,1,5-9H2,2-4H3,(H,19,21);1H3;/q2*-1; |
| InChIKey | RGQIFZLARDPOAT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|