About octanoyl chloride;toluene
octanoyl chloride;toluene (PubChem CID 175179204) has the molecular formula C15H23ClO
and a molecular weight of 254.80 g/mol. Its IUPAC name is octanoyl chloride;toluene.
Molecular Properties
| Compound Name | octanoyl chloride;toluene |
| PubChem CID | 175179204 |
| Molecular Formula | C15H23ClO |
| Molecular Weight | 254.80 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | octanoyl chloride;toluene |
| SMILES | CCCCCCCC(=O)Cl.Cc1ccccc1 |
| InChI | InChI=1S/C8H15ClO.C7H8/c1-2-3-4-5-6-7-8(9)10;1-7-5-3-2-4-6-7/h2-7H2,1H3;2-6H,1H3 |
| InChIKey | BKZCUUUYKFJKKQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.80 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octanoyl chloride;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octanoyl chloride;toluene?
The IUPAC name of octanoyl chloride;toluene (CID 175179204) is octanoyl chloride;toluene.
What is the SMILES notation for octanoyl chloride;toluene?
The canonical SMILES for octanoyl chloride;toluene is CCCCCCCC(=O)Cl.Cc1ccccc1.
What is the InChIKey of octanoyl chloride;toluene?
The InChIKey is BKZCUUUYKFJKKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15ClO.C7H8/c1-2-3-4-5-6-7-8(9)10;1-7-5-3-2-4-6-7/h2-7H2,1H3;2-6H,1H3.
What are the key properties of octanoyl chloride;toluene?
octanoyl chloride;toluene has a molecular weight of 254.80 g/mol, XLogP of 5.11, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octanoyl chloride;toluene is sourced from PubChem (CID 175179204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).