About chloroform;heptane;toluene
chloroform;heptane;toluene (PubChem CID 70374828) has the molecular formula C15H25Cl3
and a molecular weight of 311.72 g/mol. Its IUPAC name is chloroform;heptane;toluene.
Molecular Properties
| Compound Name | chloroform;heptane;toluene |
| PubChem CID | 70374828 |
| Molecular Formula | C15H25Cl3 |
| Molecular Weight | 311.72 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | chloroform;heptane;toluene |
| SMILES | CCCCCCC.Cc1ccccc1.ClC(Cl)Cl |
| InChI | InChI=1S/C7H8.C7H16.CHCl3/c1-7-5-3-2-4-6-7;1-3-5-7-6-4-2;2-1(3)4/h2-6H,1H3;3-7H2,1-2H3;1H |
| InChIKey | CZRUMIPLSMFNRA-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.72 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloroform;heptane;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroform;heptane;toluene?
The IUPAC name of chloroform;heptane;toluene (CID 70374828) is chloroform;heptane;toluene.
What is the SMILES notation for chloroform;heptane;toluene?
The canonical SMILES for chloroform;heptane;toluene is CCCCCCC.Cc1ccccc1.ClC(Cl)Cl.
What is the InChIKey of chloroform;heptane;toluene?
The InChIKey is CZRUMIPLSMFNRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8.C7H16.CHCl3/c1-7-5-3-2-4-6-7;1-3-5-7-6-4-2;2-1(3)4/h2-6H,1H3;3-7H2,1-2H3;1H.
What are the key properties of chloroform;heptane;toluene?
chloroform;heptane;toluene has a molecular weight of 311.72 g/mol, XLogP of 6.96, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloroform;heptane;toluene is sourced from PubChem (CID 70374828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).