About hexane;2-propan-2-yloxypropane;toluene
hexane;2-propan-2-yloxypropane;toluene (PubChem CID 174447414) has the molecular formula C19H36O
and a molecular weight of 280.50 g/mol. Its IUPAC name is hexane;2-propan-2-yloxypropane;toluene.
Molecular Properties
| Compound Name | hexane;2-propan-2-yloxypropane;toluene |
| PubChem CID | 174447414 |
| Molecular Formula | C19H36O |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.28 |
| IUPAC Name | hexane;2-propan-2-yloxypropane;toluene |
| SMILES | CC(C)OC(C)C.CCCCCC.Cc1ccccc1 |
| InChI | InChI=1S/C7H8.C6H14O.C6H14/c1-7-5-3-2-4-6-7;1-5(2)7-6(3)4;1-3-5-6-4-2/h2-6H,1H3;5-6H,1-4H3;3-6H2,1-2H3 |
| InChIKey | NEMGYFVFZJBEJM-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexane;2-propan-2-yloxypropane;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane;2-propan-2-yloxypropane;toluene?
The IUPAC name of hexane;2-propan-2-yloxypropane;toluene (CID 174447414) is hexane;2-propan-2-yloxypropane;toluene.
What is the SMILES notation for hexane;2-propan-2-yloxypropane;toluene?
The canonical SMILES for hexane;2-propan-2-yloxypropane;toluene is CC(C)OC(C)C.CCCCCC.Cc1ccccc1.
What is the InChIKey of hexane;2-propan-2-yloxypropane;toluene?
The InChIKey is NEMGYFVFZJBEJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8.C6H14O.C6H14/c1-7-5-3-2-4-6-7;1-5(2)7-6(3)4;1-3-5-6-4-2/h2-6H,1H3;5-6H,1-4H3;3-6H2,1-2H3.
What are the key properties of hexane;2-propan-2-yloxypropane;toluene?
hexane;2-propan-2-yloxypropane;toluene has a molecular weight of 280.50 g/mol, XLogP of 6.40, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexane;2-propan-2-yloxypropane;toluene is sourced from PubChem (CID 174447414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).