C18H25NO3 — CID 2430456
[2-oxo-2-(2,4,6-trimethylanilino)ethyl] cyclohexanecarboxylate (PubChem CID 2430456) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trimethylanilino)ethyl] cyclohexanecarboxylate.
| Compound Name | [2-oxo-2-(2,4,6-trimethylanilino)ethyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 2430456 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | [2-oxo-2-(2,4,6-trimethylanilino)ethyl] cyclohexanecarboxylate |
| SMILES | Cc1cc(C)c(NC(=O)COC(=O)C2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C18H25NO3/c1-12-9-13(2)17(14(3)10-12)19-16(20)11-22-18(21)15-7-5-4-6-8-15/h9-10,15H,4-8,11H2,1-3H3,(H,19,20) |
| InChIKey | CQBRJROHLMTCDL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |