C15H16BrF2NO3 — CID 41427514
[2-(2-bromo-4,6-difluoroanilino)-2-oxoethyl] cyclohexanecarboxylate (PubChem CID 41427514) has the molecular formula C15H16BrF2NO3 and a molecular weight of 376.20 g/mol. Its IUPAC name is [2-(2-bromo-4,6-difluoroanilino)-2-oxoethyl] cyclohexanecarboxylate.
| Compound Name | [2-(2-bromo-4,6-difluoroanilino)-2-oxoethyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 41427514 |
| Molecular Formula | C15H16BrF2NO3 |
| Molecular Weight | 376.20 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | [2-(2-bromo-4,6-difluoroanilino)-2-oxoethyl] cyclohexanecarboxylate |
| SMILES | O=C(COC(=O)C1CCCCC1)Nc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C15H16BrF2NO3/c16-11-6-10(17)7-12(18)14(11)19-13(20)8-22-15(21)9-4-2-1-3-5-9/h6-7,9H,1-5,8H2,(H,19,20) |
| InChIKey | OQYXVKXRIVFKEI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.20 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |