C14H15Cl2NO3 — CID 8020275
[2-(2,5-dichloroanilino)-2-oxoethyl] cyclopentanecarboxylate (PubChem CID 8020275) has the molecular formula C14H15Cl2NO3 and a molecular weight of 316.18 g/mol. Its IUPAC name is [2-(2,5-dichloroanilino)-2-oxoethyl] cyclopentanecarboxylate.
| Compound Name | [2-(2,5-dichloroanilino)-2-oxoethyl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 8020275 |
| Molecular Formula | C14H15Cl2NO3 |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | [2-(2,5-dichloroanilino)-2-oxoethyl] cyclopentanecarboxylate |
| SMILES | O=C(COC(=O)C1CCCC1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H15Cl2NO3/c15-10-5-6-11(16)12(7-10)17-13(18)8-20-14(19)9-3-1-2-4-9/h5-7,9H,1-4,8H2,(H,17,18) |
| InChIKey | VSPAAFXLQPXQJT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |