C20H20ClNO3S — CID 23908442
[2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] cyclopentanecarboxylate (PubChem CID 23908442) has the molecular formula C20H20ClNO3S and a molecular weight of 389.90 g/mol. Its IUPAC name is [2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] cyclopentanecarboxylate.
| Compound Name | [2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 23908442 |
| Molecular Formula | C20H20ClNO3S |
| Molecular Weight | 389.90 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | [2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl] cyclopentanecarboxylate |
| SMILES | O=C(COC(=O)C1CCCC1)Nc1ccccc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20ClNO3S/c21-15-9-11-16(12-10-15)26-18-8-4-3-7-17(18)22-19(23)13-25-20(24)14-5-1-2-6-14/h3-4,7-12,14H,1-2,5-6,13H2,(H,22,23) |
| InChIKey | WBCKMESRJYMHKC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.90 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |