C20H23ClN2O2S2 — CID 75534068
N-[2-(4-chlorophenyl)sulfanylphenyl]-2-[methyl-(1-oxothian-4-yl)amino]acetamide (PubChem CID 75534068) has the molecular formula C20H23ClN2O2S2 and a molecular weight of 423.00 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylphenyl]-2-[methyl-(1-oxothian-4-yl)amino]acetamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylphenyl]-2-[methyl-(1-oxothian-4-yl)amino]acetamide |
|---|---|
| PubChem CID | 75534068 |
| Molecular Formula | C20H23ClN2O2S2 |
| Molecular Weight | 423.00 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylphenyl]-2-[methyl-(1-oxothian-4-yl)amino]acetamide |
| SMILES | CN(CC(=O)Nc1ccccc1Sc1ccc(Cl)cc1)C1CCS(=O)CC1 |
| InChI | InChI=1S/C20H23ClN2O2S2/c1-23(16-10-12-27(25)13-11-16)14-20(24)22-18-4-2-3-5-19(18)26-17-8-6-15(21)7-9-17/h2-9,16H,10-14H2,1H3,(H,22,24) |
| InChIKey | RXCYXGMHJPBSPC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.00 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |