C26H27ClN2O3S2 — CID 21380434
2-[(4-chlorophenyl)sulfonyl-cyclohexylamino]-N-(2-phenylsulfanylphenyl)acetamide (PubChem CID 21380434) has the molecular formula C26H27ClN2O3S2 and a molecular weight of 515.10 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonyl-cyclohexylamino]-N-(2-phenylsulfanylphenyl)acetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonyl-cyclohexylamino]-N-(2-phenylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 21380434 |
| Molecular Formula | C26H27ClN2O3S2 |
| Molecular Weight | 515.10 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonyl-cyclohexylamino]-N-(2-phenylsulfanylphenyl)acetamide |
| SMILES | O=C(CN(C1CCCCC1)S(=O)(=O)c1ccc(Cl)cc1)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C26H27ClN2O3S2/c27-20-15-17-23(18-16-20)34(31,32)29(21-9-3-1-4-10-21)19-26(30)28-24-13-7-8-14-25(24)33-22-11-5-2-6-12-22/h2,5-8,11-18,21H,1,3-4,9-10,19H2,(H,28,30) |
| InChIKey | QZCUBHLVOJSYDU-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.10 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |