C26H26Cl2N2O4S — CID 21380435
N-(5-chloro-2-phenoxyphenyl)-2-[(4-chlorophenyl)sulfonyl-cyclohexylamino]acetamide (PubChem CID 21380435) has the molecular formula C26H26Cl2N2O4S and a molecular weight of 533.48 g/mol. Its IUPAC name is N-(5-chloro-2-phenoxyphenyl)-2-[(4-chlorophenyl)sulfonyl-cyclohexylamino]acetamide.
| Compound Name | N-(5-chloro-2-phenoxyphenyl)-2-[(4-chlorophenyl)sulfonyl-cyclohexylamino]acetamide |
|---|---|
| PubChem CID | 21380435 |
| Molecular Formula | C26H26Cl2N2O4S |
| Molecular Weight | 533.48 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | N-(5-chloro-2-phenoxyphenyl)-2-[(4-chlorophenyl)sulfonyl-cyclohexylamino]acetamide |
| SMILES | O=C(CN(C1CCCCC1)S(=O)(=O)c1ccc(Cl)cc1)Nc1cc(Cl)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C26H26Cl2N2O4S/c27-19-11-14-23(15-12-19)35(32,33)30(21-7-3-1-4-8-21)18-26(31)29-24-17-20(28)13-16-25(24)34-22-9-5-2-6-10-22/h2,5-6,9-17,21H,1,3-4,7-8,18H2,(H,29,31) |
| InChIKey | ATJKINOMSUIGLQ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.48 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |