C15H24ClNOPY+ — CID 159771868
[1-(4-chloro-2,6-dimethylanilino)-1-oxobutan-2-yl]-trimethylphosphanium;yttrium (PubChem CID 159771868) has the molecular formula C15H24ClNOPY+ and a molecular weight of 389.70 g/mol. Its IUPAC name is [1-(4-chloro-2,6-dimethylanilino)-1-oxobutan-2-yl]-trimethylphosphanium;yttrium.
| Compound Name | [1-(4-chloro-2,6-dimethylanilino)-1-oxobutan-2-yl]-trimethylphosphanium;yttrium |
|---|---|
| PubChem CID | 159771868 |
| Molecular Formula | C15H24ClNOPY+ |
| Molecular Weight | 389.70 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | [1-(4-chloro-2,6-dimethylanilino)-1-oxobutan-2-yl]-trimethylphosphanium;yttrium |
| SMILES | CCC(C(=O)Nc1c(C)cc(Cl)cc1C)[P+](C)(C)C.[Y] |
| InChI | InChI=1S/C15H23ClNOP.Y/c1-7-13(19(4,5)6)15(18)17-14-10(2)8-12(16)9-11(14)3;/h8-9,13H,7H2,1-6H3;/p+1 |
| InChIKey | YDTDOSRCHFJKOA-UHFFFAOYSA-O |
| XLogP | 4.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.70 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|